C25H27F3N4O3 — CID 138634647
N-[[(4R,5R)-5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 138634647) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is N-[[(4R,5R)-5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[[(4R,5R)-5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138634647 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[[(4R,5R)-5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC1(C)O[C@H](CNC(=O)c2cn3cc(C(F)(F)F)ccc3n2)[C@@H](CN2CCc3ccccc3C2)O1 |
| InChI | InChI=1S/C25H27F3N4O3/c1-24(2)34-20(21(35-24)15-31-10-9-16-5-3-4-6-17(16)12-31)11-29-23(33)19-14-32-13-18(25(26,27)28)7-8-22(32)30-19/h3-8,13-14,20-21H,9-12,15H2,1-2H3,(H,29,33)/t20-,21-/m1/s1 |
| InChIKey | KLDGLJZAOMOBGN-NHCUHLMSSA-N |
| XLogP | 3.66 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |