C25H23FN6O3 — CID 138635269
2-(4-fluorophenyl)-7-[6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 138635269) has the molecular formula C25H23FN6O3 and a molecular weight of 474.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-7-[6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(4-fluorophenyl)-7-[6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138635269 |
| Molecular Formula | C25H23FN6O3 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-(4-fluorophenyl)-7-[6-methyl-4-[(1-methylcyclopropyl)amino]furo[2,3-d]pyrimidine-5-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1oc2ncnc(NC3(C)CC3)c2c1C(=O)N1CCc2c(nc(-c3ccc(F)cc3)[nH]c2=O)C1 |
| InChI | InChI=1S/C25H23FN6O3/c1-13-18(19-21(31-25(2)8-9-25)27-12-28-23(19)35-13)24(34)32-10-7-16-17(11-32)29-20(30-22(16)33)14-3-5-15(26)6-4-14/h3-6,12H,7-11H2,1-2H3,(H,27,28,31)(H,29,30,33) |
| InChIKey | SDRAOHNGYWZWSL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |