C11H11FN2O2 — CID 138635769
3-(6-fluoro-4-methyl-2-pyridinyl)-2,5-dihydropyrrole-1-carboxylic acid (PubChem CID 138635769) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 3-(6-fluoro-4-methyl-2-pyridinyl)-2,5-dihydropyrrole-1-carboxylic acid.
| Compound Name | 3-(6-fluoro-4-methyl-2-pyridinyl)-2,5-dihydropyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 138635769 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-(6-fluoro-4-methyl-2-pyridinyl)-2,5-dihydropyrrole-1-carboxylic acid |
| SMILES | Cc1cc(F)nc(C2=CCN(C(=O)O)C2)c1 |
| InChI | InChI=1S/C11H11FN2O2/c1-7-4-9(13-10(12)5-7)8-2-3-14(6-8)11(15)16/h2,4-5H,3,6H2,1H3,(H,15,16) |
| InChIKey | NMTPDHWFZXYHCA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|