C12H14F3N3O2 — CID 138636044
4-cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid (PubChem CID 138636044) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 4-cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138636044 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-cyclopropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1nc2c(c(C3CC3)n1)CCNC2 |
| InChI | InChI=1S/C10H13N3.C2HF3O2/c1-2-7(1)10-8-3-4-11-5-9(8)12-6-13-10;3-2(4,5)1(6)7/h6-7,11H,1-5H2;(H,6,7) |
| InChIKey | LWVSJAWQSCTLKG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |