C13H16F3N3O3 — CID 138636045
2-cyclopropyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid (PubChem CID 138636045) has the molecular formula C13H16F3N3O3 and a molecular weight of 319.28 g/mol. Its IUPAC name is 2-cyclopropyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-cyclopropyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138636045 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-cyclopropyl-4-methoxy-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;2,2,2-trifluoroacetic acid |
| SMILES | COc1nc(C2CC2)nc2c1CCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H15N3O.C2HF3O2/c1-15-11-8-4-5-12-6-9(8)13-10(14-11)7-2-3-7;3-2(4,5)1(6)7/h7,12H,2-6H2,1H3;(H,6,7) |
| InChIKey | OXNFKKOJMNTACY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |