C44H45N3O — CID 138636321
2-(4a,8a-dihydronaphthalen-1-yl)-4-[3-[(10aR)-9-phenyl-1,2,3,7,8,8a,9a,10a-octahydroxanthen-9-yl]cyclohex-2-en-1-yl]-6-cyclohexa-1,3-dien-1-yl-1,3,5-triazine (PubChem CID 138636321) has the molecular formula C44H45N3O and a molecular weight of 631.86 g/mol. Its IUPAC name is 2-(4a,8a-dihydronaphthalen-1-yl)-4-[3-[(10aR)-9-phenyl-1,2,3,7,8,8a,9a,10a-octahydroxanthen-9-yl]cyclohex-2-en-1-yl]-6-cyclohexa-1,3-dien-1-yl-1,3,5-triazine.
| Compound Name | 2-(4a,8a-dihydronaphthalen-1-yl)-4-[3-[(10aR)-9-phenyl-1,2,3,7,8,8a,9a,10a-octahydroxanthen-9-yl]cyclohex-2-en-1-yl]-6-cyclohexa-1,3-dien-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 138636321 |
| Molecular Formula | C44H45N3O |
| Molecular Weight | 631.86 g/mol |
| Exact Mass | 631.36 |
| IUPAC Name | 2-(4a,8a-dihydronaphthalen-1-yl)-4-[3-[(10aR)-9-phenyl-1,2,3,7,8,8a,9a,10a-octahydroxanthen-9-yl]cyclohex-2-en-1-yl]-6-cyclohexa-1,3-dien-1-yl-1,3,5-triazine |
| SMILES | C1=CCCC(c2nc(C3=CC=CC4C=CC=CC34)nc(C3C=C(C4(c5ccccc5)C5CCCC=C5O[C@@H]5C=CCCC54)CCC3)n2)=C1 |
| InChI | InChI=1S/C44H45N3O/c1-3-16-31(17-4-1)41-45-42(47-43(46-41)36-24-14-18-30-15-7-8-23-35(30)36)32-19-13-22-34(29-32)44(33-20-5-2-6-21-33)37-25-9-11-27-39(37)48-40-28-12-10-26-38(40)44/h1-3,5-8,11,14-16,18,20-21,23-24,27-30,32,35,37-39H,4,9-10,12-13,17,19,22,25-26H2/t30?,32?,35?,37?,38?,39-,44?/m1/s1 |
| InChIKey | IMRQQHWZPBNPPZ-ZOIJZPDPSA-N |
| XLogP | 10.10 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.86 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|