About N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide
N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide (PubChem CID 138636387) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide |
| PubChem CID | 138636387 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide |
| SMILES | CCC[C@H](CCCC1=CC1)N(C)/C=N/C |
| InChI | InChI=1S/C13H24N2/c1-4-6-13(15(3)11-14-2)8-5-7-12-9-10-12/h9,11,13H,4-8,10H2,1-3H3/b14-11+/t13-/m1/s1 |
| InChIKey | UKUTXUIMNUIXLK-MBFWDRTGSA-N |
| XLogP | 3.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide?
The IUPAC name of N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide (CID 138636387) is N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide.
What is the SMILES notation for N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide?
The canonical SMILES for N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide is CCC[C@H](CCCC1=CC1)N(C)/C=N/C.
What is the InChIKey of N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide?
The InChIKey is UKUTXUIMNUIXLK-MBFWDRTGSA-N. The full InChI is InChI=1S/C13H24N2/c1-4-6-13(15(3)11-14-2)8-5-7-12-9-10-12/h9,11,13H,4-8,10H2,1-3H3/b14-11+/t13-/m1/s1.
What are the key properties of N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide?
N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide has a molecular weight of 208.35 g/mol, XLogP of 3.25, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4R)-1-(cyclopropen-1-yl)heptan-4-yl]-N,N'-dimethylmethanimidamide is sourced from PubChem (CID 138636387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).