About 1-N-ethylpent-4-ene-1,2-diimine
1-N-ethylpent-4-ene-1,2-diimine (PubChem CID 138636708) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-N-ethylpent-4-ene-1,2-diimine.
Molecular Properties
| Compound Name | 1-N-ethylpent-4-ene-1,2-diimine |
| PubChem CID | 138636708 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-N-ethylpent-4-ene-1,2-diimine |
| SMILES | [H]/N=C(/C=N/CC)CC=C |
| InChI | InChI=1S/C7H12N2/c1-3-5-7(8)6-9-4-2/h3,6,8H,1,4-5H2,2H3/b8-7+,9-6+ |
| InChIKey | VWHIXEDKYWIKQM-KHHFIZIMSA-N |
| XLogP | 1.67 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-ethylpent-4-ene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-ethylpent-4-ene-1,2-diimine?
The IUPAC name of 1-N-ethylpent-4-ene-1,2-diimine (CID 138636708) is 1-N-ethylpent-4-ene-1,2-diimine.
What is the SMILES notation for 1-N-ethylpent-4-ene-1,2-diimine?
The canonical SMILES for 1-N-ethylpent-4-ene-1,2-diimine is [H]/N=C(/C=N/CC)CC=C.
What is the InChIKey of 1-N-ethylpent-4-ene-1,2-diimine?
The InChIKey is VWHIXEDKYWIKQM-KHHFIZIMSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-5-7(8)6-9-4-2/h3,6,8H,1,4-5H2,2H3/b8-7+,9-6+.
What are the key properties of 1-N-ethylpent-4-ene-1,2-diimine?
1-N-ethylpent-4-ene-1,2-diimine has a molecular weight of 124.19 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-ethylpent-4-ene-1,2-diimine is sourced from PubChem (CID 138636708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).