C24H33ClN2 — CID 138636909
2-(2-chloropropan-2-yl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 138636909) has the molecular formula C24H33ClN2 and a molecular weight of 385.00 g/mol. Its IUPAC name is 2-(2-chloropropan-2-yl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 2-(2-chloropropan-2-yl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 138636909 |
| Molecular Formula | C24H33ClN2 |
| Molecular Weight | 385.00 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-(2-chloropropan-2-yl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2C(C)(C)Cl)c(C)c1 |
| InChI | InChI=1S/C24H33ClN2/c1-15-11-17(3)21(18(4)12-15)26-9-10-27(23(26)24(7,8)25)22-19(5)13-16(2)14-20(22)6/h11-14,23H,9-10H2,1-8H3 |
| InChIKey | CGEZQWYWDWGJTH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|