C36H54FN — CID 138637184
N-[(1E,4E,6Z,9E)-4-ethenyl-2-ethyl-9-fluoro-3,7,12-trimethyl-10-prop-1-en-2-yl-3-[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl]trideca-1,4,6,9-tetraenyl]ethanimine (PubChem CID 138637184) has the molecular formula C36H54FN and a molecular weight of 519.83 g/mol. Its IUPAC name is N-[(1E,4E,6Z,9E)-4-ethenyl-2-ethyl-9-fluoro-3,7,12-trimethyl-10-prop-1-en-2-yl-3-[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl]trideca-1,4,6,9-tetraenyl]ethanimine.
| Compound Name | N-[(1E,4E,6Z,9E)-4-ethenyl-2-ethyl-9-fluoro-3,7,12-trimethyl-10-prop-1-en-2-yl-3-[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl]trideca-1,4,6,9-tetraenyl]ethanimine |
|---|---|
| PubChem CID | 138637184 |
| Molecular Formula | C36H54FN |
| Molecular Weight | 519.83 g/mol |
| Exact Mass | 519.42 |
| IUPAC Name | N-[(1E,4E,6Z,9E)-4-ethenyl-2-ethyl-9-fluoro-3,7,12-trimethyl-10-prop-1-en-2-yl-3-[(3E,5E)-6,7,7-trimethylocta-1,3,5-trien-3-yl]trideca-1,4,6,9-tetraenyl]ethanimine |
| SMILES | C=C/C(=C\C=C(\C)C/C(F)=C(/CC(C)C)C(=C)C)C(C)(/C(C=C)=C/C=C(\C)C(C)(C)C)/C(=C/N=C/C)CC |
| InChI | InChI=1S/C36H54FN/c1-15-30(21-19-28(9)24-34(37)33(27(7)8)23-26(5)6)36(14,32(17-3)25-38-18-4)31(16-2)22-20-29(10)35(11,12)13/h15-16,18-22,25-26H,1-2,7,17,23-24H2,3-6,8-14H3/b28-19-,29-20+,30-21+,31-22+,32-25+,34-33+,38-18+ |
| InChIKey | LJGKIRRMXCTVGZ-XOOGTECXSA-N |
| XLogP | 11.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.83 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|