C20H24N2O4S — CID 138637631
1-[5-(1-benzofuran-5-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2,2-bis(hydroxymethyl)butan-1-one (PubChem CID 138637631) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[5-(1-benzofuran-5-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2,2-bis(hydroxymethyl)butan-1-one.
| Compound Name | 1-[5-(1-benzofuran-5-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2,2-bis(hydroxymethyl)butan-1-one |
|---|---|
| PubChem CID | 138637631 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[5-(1-benzofuran-5-ylsulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2,2-bis(hydroxymethyl)butan-1-one |
| SMILES | CCC(CO)(CO)C(=O)N1CC2=C(CN(Sc3ccc4occc4c3)C2)C1 |
| InChI | InChI=1S/C20H24N2O4S/c1-2-20(12-23,13-24)19(25)21-8-15-10-22(11-16(15)9-21)27-17-3-4-18-14(7-17)5-6-26-18/h3-7,23-24H,2,8-13H2,1H3 |
| InChIKey | UGRLFUGARMTULB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|