C37H22N6S — CID 138640187
20-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-thia-5,7,20-triazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaene (PubChem CID 138640187) has the molecular formula C37H22N6S and a molecular weight of 582.69 g/mol. Its IUPAC name is 20-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-thia-5,7,20-triazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaene.
| Compound Name | 20-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-thia-5,7,20-triazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 138640187 |
| Molecular Formula | C37H22N6S |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 20-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-thia-5,7,20-triazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ccccc5c5cc6sc7cncnc7c6cc54)c3)n2)cc1 |
| InChI | InChI=1S/C37H22N6S/c1-3-10-23(11-4-1)35-40-36(24-12-5-2-6-13-24)42-37(41-35)25-14-9-15-26(18-25)43-30-17-8-7-16-27(30)28-20-32-29(19-31(28)43)34-33(44-32)21-38-22-39-34/h1-22H |
| InChIKey | KWUIKCVIFRRQQU-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |