C18H18N4O4 — CID 138641184
2-[4-(2-hydroxy-2-methoxyethyl)phenoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 138641184) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-[4-(2-hydroxy-2-methoxyethyl)phenoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 2-[4-(2-hydroxy-2-methoxyethyl)phenoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 138641184 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[4-(2-hydroxy-2-methoxyethyl)phenoxy]-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | COC(O)Cc1ccc(Oc2ccccc2C(=O)Nc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C18H18N4O4/c1-25-16(23)10-12-6-8-13(9-7-12)26-15-5-3-2-4-14(15)17(24)21-18-19-11-20-22-18/h2-9,11,16,23H,10H2,1H3,(H2,19,20,21,22,24) |
| InChIKey | AVAKCVVUGWEAPY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|