About 2-(2-methylbutyl)-1,2-thiazolidine
2-(2-methylbutyl)-1,2-thiazolidine (PubChem CID 138641290) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is 2-(2-methylbutyl)-1,2-thiazolidine.
Molecular Properties
| Compound Name | 2-(2-methylbutyl)-1,2-thiazolidine |
| PubChem CID | 138641290 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 2-(2-methylbutyl)-1,2-thiazolidine |
| SMILES | CCC(C)CN1CCCS1 |
| InChI | InChI=1S/C8H17NS/c1-3-8(2)7-9-5-4-6-10-9/h8H,3-7H2,1-2H3 |
| InChIKey | ZIRYWQITSNUMAX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylbutyl)-1,2-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylbutyl)-1,2-thiazolidine?
The IUPAC name of 2-(2-methylbutyl)-1,2-thiazolidine (CID 138641290) is 2-(2-methylbutyl)-1,2-thiazolidine.
What is the SMILES notation for 2-(2-methylbutyl)-1,2-thiazolidine?
The canonical SMILES for 2-(2-methylbutyl)-1,2-thiazolidine is CCC(C)CN1CCCS1.
What is the InChIKey of 2-(2-methylbutyl)-1,2-thiazolidine?
The InChIKey is ZIRYWQITSNUMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS/c1-3-8(2)7-9-5-4-6-10-9/h8H,3-7H2,1-2H3.
What are the key properties of 2-(2-methylbutyl)-1,2-thiazolidine?
2-(2-methylbutyl)-1,2-thiazolidine has a molecular weight of 159.30 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylbutyl)-1,2-thiazolidine is sourced from PubChem (CID 138641290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).