About 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide
4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide (PubChem CID 138641428) has the molecular formula C25H27N3O
and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide.
Molecular Properties
| Compound Name | 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide |
| PubChem CID | 138641428 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide |
| SMILES | C=CC(=C)N(CC1CCCC1)c1cccc(-c2ccc(C(N)=O)c3[nH]ccc23)c1 |
| InChI | InChI=1S/C25H27N3O/c1-3-17(2)28(16-18-7-4-5-8-18)20-10-6-9-19(15-20)21-11-12-23(25(26)29)24-22(21)13-14-27-24/h3,6,9-15,18,27H,1-2,4-5,7-8,16H2,(H2,26,29) |
| InChIKey | TYYHFEAIIDSNHE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide?
The IUPAC name of 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide (CID 138641428) is 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide.
What is the SMILES notation for 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide?
The canonical SMILES for 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide is C=CC(=C)N(CC1CCCC1)c1cccc(-c2ccc(C(N)=O)c3[nH]ccc23)c1.
What is the InChIKey of 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide?
The InChIKey is TYYHFEAIIDSNHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O/c1-3-17(2)28(16-18-7-4-5-8-18)20-10-6-9-19(15-20)21-11-12-23(25(26)29)24-22(21)13-14-27-24/h3,6,9-15,18,27H,1-2,4-5,7-8,16H2,(H2,26,29).
What are the key properties of 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide?
4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide has a molecular weight of 385.51 g/mol, XLogP of 5.63, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[buta-1,3-dien-2-yl(cyclopentylmethyl)amino]phenyl]-1H-indole-7-carboxamide is sourced from PubChem (CID 138641428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).