C15H29N — CID 138641796
N-(3,3,4,4,5-pentamethyl-2-propylhex-5-enyl)methanimine (PubChem CID 138641796) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is N-(3,3,4,4,5-pentamethyl-2-propylhex-5-enyl)methanimine.
| Compound Name | N-(3,3,4,4,5-pentamethyl-2-propylhex-5-enyl)methanimine |
|---|---|
| PubChem CID | 138641796 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | N-(3,3,4,4,5-pentamethyl-2-propylhex-5-enyl)methanimine |
| SMILES | C=NCC(CCC)C(C)(C)C(C)(C)C(=C)C |
| InChI | InChI=1S/C15H29N/c1-9-10-13(11-16-8)15(6,7)14(4,5)12(2)3/h13H,2,8-11H2,1,3-7H3 |
| InChIKey | ZDXABEDLEHBWOG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|