C26H28Cl2N2O2 — CID 138641828
4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-[[cyclopropyl(pyridin-2-yl)methyl]amino]pentane-1,1-diol (PubChem CID 138641828) has the molecular formula C26H28Cl2N2O2 and a molecular weight of 471.43 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-[[cyclopropyl(pyridin-2-yl)methyl]amino]pentane-1,1-diol.
| Compound Name | 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-[[cyclopropyl(pyridin-2-yl)methyl]amino]pentane-1,1-diol |
|---|---|
| PubChem CID | 138641828 |
| Molecular Formula | C26H28Cl2N2O2 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(4-chlorophenyl)-5-[[cyclopropyl(pyridin-2-yl)methyl]amino]pentane-1,1-diol |
| SMILES | OC(O)CCC(c1cccc(Cl)c1)C(NC(c1ccccn1)C1CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O2/c27-20-11-9-17(10-12-20)25(30-26(18-7-8-18)23-6-1-2-15-29-23)22(13-14-24(31)32)19-4-3-5-21(28)16-19/h1-6,9-12,15-16,18,22,24-26,30-32H,7-8,13-14H2 |
| InChIKey | ZMSUCDCMBNJFNU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|