About N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide
N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide (PubChem CID 138641838) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide |
| PubChem CID | 138641838 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide |
| SMILES | C=CCC(CCCO)C(=O)NC(CO)C(C)(C)C |
| InChI | InChI=1S/C14H27NO3/c1-5-7-11(8-6-9-16)13(18)15-12(10-17)14(2,3)4/h5,11-12,16-17H,1,6-10H2,2-4H3,(H,15,18) |
| InChIKey | ZYATYDCXEDOCGU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide?
The IUPAC name of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide (CID 138641838) is N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide.
What is the SMILES notation for N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide?
The canonical SMILES for N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide is C=CCC(CCCO)C(=O)NC(CO)C(C)(C)C.
What is the InChIKey of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide?
The InChIKey is ZYATYDCXEDOCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-5-7-11(8-6-9-16)13(18)15-12(10-17)14(2,3)4/h5,11-12,16-17H,1,6-10H2,2-4H3,(H,15,18).
What are the key properties of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide?
N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide has a molecular weight of 257.37 g/mol, XLogP of 1.47, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-3,3-dimethylbutan-2-yl)-2-(3-hydroxypropyl)pent-4-enamide is sourced from PubChem (CID 138641838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).