C14H23N — CID 138641922
N-[(1Z,3Z)-3-ethylidene-4,4-dimethyl-2-propan-2-ylhexa-1,5-dienyl]methanimine (PubChem CID 138641922) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-ethylidene-4,4-dimethyl-2-propan-2-ylhexa-1,5-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-3-ethylidene-4,4-dimethyl-2-propan-2-ylhexa-1,5-dienyl]methanimine |
|---|---|
| PubChem CID | 138641922 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-[(1Z,3Z)-3-ethylidene-4,4-dimethyl-2-propan-2-ylhexa-1,5-dienyl]methanimine |
| SMILES | C=CC(C)(C)C(=C/C)/C(=C\N=C)C(C)C |
| InChI | InChI=1S/C14H23N/c1-8-13(14(5,6)9-2)12(10-15-7)11(3)4/h8-11H,2,7H2,1,3-6H3/b12-10-,13-8+ |
| InChIKey | WJMUXILQKNQYFN-DTKJOJMOSA-N |
| XLogP | 4.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|