C30H43N3O4 — CID 138642347
2-methylpropyl 2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxolan-3-ylmethyl)benzimidazol-5-yl]methylamino]butanoate (PubChem CID 138642347) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is 2-methylpropyl 2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxolan-3-ylmethyl)benzimidazol-5-yl]methylamino]butanoate.
| Compound Name | 2-methylpropyl 2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxolan-3-ylmethyl)benzimidazol-5-yl]methylamino]butanoate |
|---|---|
| PubChem CID | 138642347 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 2-methylpropyl 2-[[2-[(2E,4Z)-5-methyl-6-oxoocta-2,4-dien-3-yl]-1-(oxolan-3-ylmethyl)benzimidazol-5-yl]methylamino]butanoate |
| SMILES | C/C=C(\C=C(\C)C(=O)CC)c1nc2cc(CNC(CC)C(=O)OCC(C)C)ccc2n1CC1CCOC1 |
| InChI | InChI=1S/C30H43N3O4/c1-7-24(14-21(6)28(34)9-3)29-32-26-15-22(16-31-25(8-2)30(35)37-18-20(4)5)10-11-27(26)33(29)17-23-12-13-36-19-23/h7,10-11,14-15,20,23,25,31H,8-9,12-13,16-19H2,1-6H3/b21-14-,24-7+ |
| InChIKey | JZRUVNFTCYPXHP-VIGWYPFUSA-N |
| XLogP | 5.47 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|