C30H44N2 — CID 138642388
(3S,4S)-N-[[3-[[(3E,4Z)-3-ethylidene-5,6-dimethylhepta-4,6-dien-2-ylidene]amino]-4-methylphenyl]methyl]-3,7-dimethyl-5-methylideneoct-1-en-4-amine (PubChem CID 138642388) has the molecular formula C30H44N2 and a molecular weight of 432.70 g/mol. Its IUPAC name is (3S,4S)-N-[[3-[[(3E,4Z)-3-ethylidene-5,6-dimethylhepta-4,6-dien-2-ylidene]amino]-4-methylphenyl]methyl]-3,7-dimethyl-5-methylideneoct-1-en-4-amine.
| Compound Name | (3S,4S)-N-[[3-[[(3E,4Z)-3-ethylidene-5,6-dimethylhepta-4,6-dien-2-ylidene]amino]-4-methylphenyl]methyl]-3,7-dimethyl-5-methylideneoct-1-en-4-amine |
|---|---|
| PubChem CID | 138642388 |
| Molecular Formula | C30H44N2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | (3S,4S)-N-[[3-[[(3E,4Z)-3-ethylidene-5,6-dimethylhepta-4,6-dien-2-ylidene]amino]-4-methylphenyl]methyl]-3,7-dimethyl-5-methylideneoct-1-en-4-amine |
| SMILES | C=C[C@H](C)[C@H](NCc1ccc(C)c(/N=C(C)/C(/C=C(/C)C(=C)C)=C/C)c1)C(=C)CC(C)C |
| InChI | InChI=1S/C30H44N2/c1-12-22(7)30(25(10)16-20(3)4)31-19-27-15-14-23(8)29(18-27)32-26(11)28(13-2)17-24(9)21(5)6/h12-15,17-18,20,22,30-31H,1,5,10,16,19H2,2-4,6-9,11H3/b24-17-,28-13+,32-26+/t22-,30-/m0/s1 |
| InChIKey | KSWRQDCKYMAWFQ-XODVPHLASA-N |
| XLogP | 8.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|