C25H39N3O — CID 138642478
(Z,4E)-5-[5-[[[(2R)-butan-2-yl]amino]methyl]-2-methylphenyl]imino-4-(dimethylaminomethylidene)-2,6-dimethyloct-2-enal (PubChem CID 138642478) has the molecular formula C25H39N3O and a molecular weight of 397.61 g/mol. Its IUPAC name is (Z,4E)-5-[5-[[[(2R)-butan-2-yl]amino]methyl]-2-methylphenyl]imino-4-(dimethylaminomethylidene)-2,6-dimethyloct-2-enal.
| Compound Name | (Z,4E)-5-[5-[[[(2R)-butan-2-yl]amino]methyl]-2-methylphenyl]imino-4-(dimethylaminomethylidene)-2,6-dimethyloct-2-enal |
|---|---|
| PubChem CID | 138642478 |
| Molecular Formula | C25H39N3O |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | (Z,4E)-5-[5-[[[(2R)-butan-2-yl]amino]methyl]-2-methylphenyl]imino-4-(dimethylaminomethylidene)-2,6-dimethyloct-2-enal |
| SMILES | CCC(C)C(=N\c1cc(CN[C@H](C)CC)ccc1C)/C(/C=C(/C)C=O)=C/N(C)C |
| InChI | InChI=1S/C25H39N3O/c1-9-19(4)25(23(16-28(7)8)13-18(3)17-29)27-24-14-22(12-11-20(24)5)15-26-21(6)10-2/h11-14,16-17,19,21,26H,9-10,15H2,1-8H3/b18-13-,23-16+,27-25+/t19?,21-/m1/s1 |
| InChIKey | VDGVKOBWIAQGMM-WRBMOXNISA-N |
| XLogP | 5.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|