C23H33N3O2 — CID 138642623
(3R,5Z,7E)-7-[5-(aminomethyl)-1-(1-methoxypropan-2-yl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one (PubChem CID 138642623) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (3R,5Z,7E)-7-[5-(aminomethyl)-1-(1-methoxypropan-2-yl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one.
| Compound Name | (3R,5Z,7E)-7-[5-(aminomethyl)-1-(1-methoxypropan-2-yl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one |
|---|---|
| PubChem CID | 138642623 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (3R,5Z,7E)-7-[5-(aminomethyl)-1-(1-methoxypropan-2-yl)benzimidazol-2-yl]-3,5-dimethylnona-5,7-dien-4-one |
| SMILES | C/C=C(\C=C(\C)C(=O)[C@H](C)CC)c1nc2cc(CN)ccc2n1C(C)COC |
| InChI | InChI=1S/C23H33N3O2/c1-7-15(3)22(27)16(4)11-19(8-2)23-25-20-12-18(13-24)9-10-21(20)26(23)17(5)14-28-6/h8-12,15,17H,7,13-14,24H2,1-6H3/b16-11-,19-8+/t15-,17?/m1/s1 |
| InChIKey | APDWFCFQJQOKLA-JOKUJSDBSA-N |
| XLogP | 4.67 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|