C29H47O4P — CID 138642673
(4Z,7E,9E,11Z)-9,11-ditert-butyl-2-hydroxy-5-methylidene-4-[(E)-2,2,6,6-tetramethylhept-4-en-3-ylidene]-1,3-dioxa-2λ5-phosphacyclododeca-7,9,11-triene 2-oxide (PubChem CID 138642673) has the molecular formula C29H47O4P and a molecular weight of 490.67 g/mol. Its IUPAC name is (4Z,7E,9E,11Z)-9,11-ditert-butyl-2-hydroxy-5-methylidene-4-[(E)-2,2,6,6-tetramethylhept-4-en-3-ylidene]-1,3-dioxa-2λ5-phosphacyclododeca-7,9,11-triene 2-oxide.
| Compound Name | (4Z,7E,9E,11Z)-9,11-ditert-butyl-2-hydroxy-5-methylidene-4-[(E)-2,2,6,6-tetramethylhept-4-en-3-ylidene]-1,3-dioxa-2λ5-phosphacyclododeca-7,9,11-triene 2-oxide |
|---|---|
| PubChem CID | 138642673 |
| Molecular Formula | C29H47O4P |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | (4Z,7E,9E,11Z)-9,11-ditert-butyl-2-hydroxy-5-methylidene-4-[(E)-2,2,6,6-tetramethylhept-4-en-3-ylidene]-1,3-dioxa-2λ5-phosphacyclododeca-7,9,11-triene 2-oxide |
| SMILES | C=C1C/C=C/C(C(C)(C)C)=C\C(C(C)(C)C)=C\OP(=O)(O)O/C1=C(/C=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H47O4P/c1-21-15-14-16-22(27(5,6)7)19-23(28(8,9)10)20-32-34(30,31)33-25(21)24(29(11,12)13)17-18-26(2,3)4/h14,16-20H,1,15H2,2-13H3,(H,30,31)/b16-14+,18-17+,22-19+,23-20-,25-24- |
| InChIKey | HDQQRZYZEUNDOW-KMDJJNMVSA-N |
| XLogP | 9.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|