C39H41N9O4 — CID 138643455
tert-butyl N-[1-[3-[(2E,4E)-5-(methylideneamino)-4-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]penta-2,4-dien-2-yl]-1,2,4-oxadiazole-5-carbonyl]piperidin-4-yl]carbamate (PubChem CID 138643455) has the molecular formula C39H41N9O4 and a molecular weight of 699.82 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[(2E,4E)-5-(methylideneamino)-4-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]penta-2,4-dien-2-yl]-1,2,4-oxadiazole-5-carbonyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[(2E,4E)-5-(methylideneamino)-4-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]penta-2,4-dien-2-yl]-1,2,4-oxadiazole-5-carbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 138643455 |
| Molecular Formula | C39H41N9O4 |
| Molecular Weight | 699.82 g/mol |
| Exact Mass | 699.33 |
| IUPAC Name | tert-butyl N-[1-[3-[(2E,4E)-5-(methylideneamino)-4-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]penta-2,4-dien-2-yl]-1,2,4-oxadiazole-5-carbonyl]piperidin-4-yl]carbamate |
| SMILES | C=N/C=C(\C=C(/C)c1noc(C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)n1)c1nc(NCc2ccccn2)c2c(-c3ccccc3)cccc2n1 |
| InChI | InChI=1S/C39H41N9O4/c1-25(33-46-36(52-47-33)37(49)48-20-17-28(18-21-48)43-38(50)51-39(2,3)4)22-27(23-40-5)34-44-31-16-11-15-30(26-12-7-6-8-13-26)32(31)35(45-34)42-24-29-14-9-10-19-41-29/h6-16,19,22-23,28H,5,17-18,20-21,24H2,1-4H3,(H,43,50)(H,42,44,45)/b25-22+,27-23+ |
| InChIKey | WYLBEASMWGSRGX-ZCXUZHAZSA-N |
| XLogP | 6.96 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|