C17H15N3O4 — CID 138643473
N-(2-formylimidazo[1,2-a]pyridin-6-yl)-4-(methoxymethoxy)benzamide (PubChem CID 138643473) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is N-(2-formylimidazo[1,2-a]pyridin-6-yl)-4-(methoxymethoxy)benzamide.
| Compound Name | N-(2-formylimidazo[1,2-a]pyridin-6-yl)-4-(methoxymethoxy)benzamide |
|---|---|
| PubChem CID | 138643473 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(2-formylimidazo[1,2-a]pyridin-6-yl)-4-(methoxymethoxy)benzamide |
| SMILES | COCOc1ccc(C(=O)Nc2ccc3nc(C=O)cn3c2)cc1 |
| InChI | InChI=1S/C17H15N3O4/c1-23-11-24-15-5-2-12(3-6-15)17(22)19-13-4-7-16-18-14(10-21)9-20(16)8-13/h2-10H,11H2,1H3,(H,19,22) |
| InChIKey | LEPYRDYHXRZWGZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|