C35H39O7P — CID 138643540
4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-butyl-2H-1,3-benzoxaphosphole (PubChem CID 138643540) has the molecular formula C35H39O7P and a molecular weight of 602.66 g/mol. Its IUPAC name is 4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-butyl-2H-1,3-benzoxaphosphole.
| Compound Name | 4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-butyl-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 138643540 |
| Molecular Formula | C35H39O7P |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 4-[3,5-bis(3,5-dimethoxyphenyl)-2,6-dimethoxyphenyl]-3-butyl-2H-1,3-benzoxaphosphole |
| SMILES | CCCCP1COc2cccc(-c3c(OC)c(-c4cc(OC)cc(OC)c4)cc(-c4cc(OC)cc(OC)c4)c3OC)c21 |
| InChI | InChI=1S/C35H39O7P/c1-8-9-13-43-21-42-31-12-10-11-28(35(31)43)32-33(40-6)29(22-14-24(36-2)18-25(15-22)37-3)20-30(34(32)41-7)23-16-26(38-4)19-27(17-23)39-5/h10-12,14-20H,8-9,13,21H2,1-7H3 |
| InChIKey | MAQRNUHIUAUEMF-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|