About 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine
1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine (PubChem CID 138644624) has the molecular formula C12H29N3S
and a molecular weight of 247.45 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine |
| PubChem CID | 138644624 |
| Molecular Formula | C12H29N3S |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine |
| SMILES | CNCCN(C)CC(CCSC(C)C)NC |
| InChI | InChI=1S/C12H29N3S/c1-11(2)16-9-6-12(14-4)10-15(5)8-7-13-3/h11-14H,6-10H2,1-5H3 |
| InChIKey | JNHDVKGBVHSFFI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine?
The IUPAC name of 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine (CID 138644624) is 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine.
What is the SMILES notation for 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine?
The canonical SMILES for 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine is CNCCN(C)CC(CCSC(C)C)NC.
What is the InChIKey of 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine?
The InChIKey is JNHDVKGBVHSFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H29N3S/c1-11(2)16-9-6-12(14-4)10-15(5)8-7-13-3/h11-14H,6-10H2,1-5H3.
What are the key properties of 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine?
1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine has a molecular weight of 247.45 g/mol, XLogP of 1.26, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]-4-propan-2-ylsulfanylbutane-1,2-diamine is sourced from PubChem (CID 138644624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).