C25H49ClFN7O — CID 138644970
3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methylazocan-2-yl]-N-[5-chloro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide (PubChem CID 138644970) has the molecular formula C25H49ClFN7O and a molecular weight of 518.17 g/mol. Its IUPAC name is 3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methylazocan-2-yl]-N-[5-chloro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methylazocan-2-yl]-N-[5-chloro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 138644970 |
| Molecular Formula | C25H49ClFN7O |
| Molecular Weight | 518.17 g/mol |
| Exact Mass | 517.37 |
| IUPAC Name | 3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methylazocan-2-yl]-N-[5-chloro-4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
| SMILES | CCCC[C@]1(C)CCC(F)CNC(C(C(=O)NC2CNCC(Cl)C2N2CCN(C)CC2)C(N)N)C1 |
| InChI | InChI=1S/C25H49ClFN7O/c1-4-5-7-25(2)8-6-17(27)14-31-19(13-25)21(23(28)29)24(35)32-20-16-30-15-18(26)22(20)34-11-9-33(3)10-12-34/h17-23,30-31H,4-16,28-29H2,1-3H3,(H,32,35)/t17?,18?,19?,20?,21?,22?,25-/m1/s1 |
| InChIKey | FQUIRIMQGWDUQT-QLKOWSNDSA-N |
| XLogP | 0.83 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|