C26H52ClN7O2 — CID 138645062
3,3-diamino-2-[(4R)-7-chloro-4-methyl-4-propylazocan-2-yl]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide (PubChem CID 138645062) has the molecular formula C26H52ClN7O2 and a molecular weight of 530.20 g/mol. Its IUPAC name is 3,3-diamino-2-[(4R)-7-chloro-4-methyl-4-propylazocan-2-yl]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-[(4R)-7-chloro-4-methyl-4-propylazocan-2-yl]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 138645062 |
| Molecular Formula | C26H52ClN7O2 |
| Molecular Weight | 530.20 g/mol |
| Exact Mass | 529.39 |
| IUPAC Name | 3,3-diamino-2-[(4R)-7-chloro-4-methyl-4-propylazocan-2-yl]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CCC[C@]1(C)CCC(Cl)CNC(C(C(=O)NC2CNCCC2N2CCN(CCOC)CC2)C(N)N)C1 |
| InChI | InChI=1S/C26H52ClN7O2/c1-4-7-26(2)8-5-19(27)17-31-20(16-26)23(24(28)29)25(35)32-21-18-30-9-6-22(21)34-12-10-33(11-13-34)14-15-36-3/h19-24,30-31H,4-18,28-29H2,1-3H3,(H,32,35)/t19?,20?,21?,22?,23?,26-/m1/s1 |
| InChIKey | XVHCOYZCJNZOJJ-XOJCXKGYSA-N |
| XLogP | 0.51 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|