About 6-bromo-4,5-difluoro-4H-azepine
6-bromo-4,5-difluoro-4H-azepine (PubChem CID 138645425) has the molecular formula C6H4BrF2N
and a molecular weight of 208.01 g/mol. Its IUPAC name is 6-bromo-4,5-difluoro-4H-azepine.
Molecular Properties
| Compound Name | 6-bromo-4,5-difluoro-4H-azepine |
| PubChem CID | 138645425 |
| Molecular Formula | C6H4BrF2N |
| Molecular Weight | 208.01 g/mol |
| Exact Mass | 206.95 |
| IUPAC Name | 6-bromo-4,5-difluoro-4H-azepine |
| SMILES | FC1=C(Br)C=NC=CC1F |
| InChI | InChI=1S/C6H4BrF2N/c7-4-3-10-2-1-5(8)6(4)9/h1-3,5H |
| InChIKey | YYMFLDMOVUPDGA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.01 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-4,5-difluoro-4H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,5-difluoro-4H-azepine?
The IUPAC name of 6-bromo-4,5-difluoro-4H-azepine (CID 138645425) is 6-bromo-4,5-difluoro-4H-azepine.
What is the SMILES notation for 6-bromo-4,5-difluoro-4H-azepine?
The canonical SMILES for 6-bromo-4,5-difluoro-4H-azepine is FC1=C(Br)C=NC=CC1F.
What is the InChIKey of 6-bromo-4,5-difluoro-4H-azepine?
The InChIKey is YYMFLDMOVUPDGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF2N/c7-4-3-10-2-1-5(8)6(4)9/h1-3,5H.
What are the key properties of 6-bromo-4,5-difluoro-4H-azepine?
6-bromo-4,5-difluoro-4H-azepine has a molecular weight of 208.01 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,5-difluoro-4H-azepine is sourced from PubChem (CID 138645425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).