About (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine
(3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine (PubChem CID 138645563) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine.
Molecular Properties
| Compound Name | (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine |
| PubChem CID | 138645563 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine |
| SMILES | C=CC(=C)NCC(C)[C@@H](C)F |
| InChI | InChI=1S/C9H16FN/c1-5-8(3)11-6-7(2)9(4)10/h5,7,9,11H,1,3,6H2,2,4H3/t7?,9-/m1/s1 |
| InChIKey | JFYDTPORAVMHQB-NHSZFOGYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine?
The IUPAC name of (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine (CID 138645563) is (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine.
What is the SMILES notation for (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine?
The canonical SMILES for (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine is C=CC(=C)NCC(C)[C@@H](C)F.
What is the InChIKey of (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine?
The InChIKey is JFYDTPORAVMHQB-NHSZFOGYSA-N. The full InChI is InChI=1S/C9H16FN/c1-5-8(3)11-6-7(2)9(4)10/h5,7,9,11H,1,3,6H2,2,4H3/t7?,9-/m1/s1.
What are the key properties of (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine?
(3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine has a molecular weight of 157.23 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbutan-1-amine is sourced from PubChem (CID 138645563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).