About 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine
1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine (PubChem CID 138645601) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine |
| PubChem CID | 138645601 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine |
| SMILES | C=C(CNCC/C=C/C=C=N)NC |
| InChI | InChI=1S/C10H17N3/c1-10(12-2)9-13-8-6-4-3-5-7-11/h3-5,11-13H,1,6,8-9H2,2H3/b4-3+ |
| InChIKey | JVQYKPDKORYTKH-ONEGZZNKSA-N |
| XLogP | 1.06 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine?
The IUPAC name of 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine (CID 138645601) is 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine.
What is the SMILES notation for 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine?
The canonical SMILES for 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine is C=C(CNCC/C=C/C=C=N)NC.
What is the InChIKey of 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine?
The InChIKey is JVQYKPDKORYTKH-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H17N3/c1-10(12-2)9-13-8-6-4-3-5-7-11/h3-5,11-13H,1,6,8-9H2,2H3/b4-3+.
What are the key properties of 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine?
1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine has a molecular weight of 179.27 g/mol, XLogP of 1.06, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(3E)-6-iminohexa-3,5-dienyl]-2-N-methylprop-2-ene-1,2-diamine is sourced from PubChem (CID 138645601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).