C7H11NO2 — CID 138645603
(4R)-2-azabicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 138645603) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (4R)-2-azabicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (4R)-2-azabicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 138645603 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (4R)-2-azabicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | O=C(O)C12CC[C@@H](CN1)C2 |
| InChI | InChI=1S/C7H11NO2/c9-6(10)7-2-1-5(3-7)4-8-7/h5,8H,1-4H2,(H,9,10)/t5-,7?/m1/s1 |
| InChIKey | HKUIKOCWQUWKQK-FOUAAFFMSA-N |
| XLogP | 0.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |