About 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol
1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol (PubChem CID 138645646) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol |
| PubChem CID | 138645646 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol |
| SMILES | NC1=CNCC=C1N1CCC(O)CC1 |
| InChI | InChI=1S/C10H17N3O/c11-9-7-12-4-1-10(9)13-5-2-8(14)3-6-13/h1,7-8,12,14H,2-6,11H2 |
| InChIKey | IIDUIOKIFNQAIJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol?
The IUPAC name of 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol (CID 138645646) is 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol.
What is the SMILES notation for 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol?
The canonical SMILES for 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol is NC1=CNCC=C1N1CCC(O)CC1.
What is the InChIKey of 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol?
The InChIKey is IIDUIOKIFNQAIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c11-9-7-12-4-1-10(9)13-5-2-8(14)3-6-13/h1,7-8,12,14H,2-6,11H2.
What are the key properties of 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol?
1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol has a molecular weight of 195.27 g/mol, XLogP of -0.27, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-1,2-dihydropyridin-4-yl)piperidin-4-ol is sourced from PubChem (CID 138645646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).