C15H29FN4 — CID 138645869
3-cyclohexyl-5-fluoro-4-(3-methylimidazolidin-4-yl)piperidin-3-amine (PubChem CID 138645869) has the molecular formula C15H29FN4 and a molecular weight of 284.42 g/mol. Its IUPAC name is 3-cyclohexyl-5-fluoro-4-(3-methylimidazolidin-4-yl)piperidin-3-amine.
| Compound Name | 3-cyclohexyl-5-fluoro-4-(3-methylimidazolidin-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 138645869 |
| Molecular Formula | C15H29FN4 |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 3-cyclohexyl-5-fluoro-4-(3-methylimidazolidin-4-yl)piperidin-3-amine |
| SMILES | CN1CNCC1C1C(F)CNCC1(N)C1CCCCC1 |
| InChI | InChI=1S/C15H29FN4/c1-20-10-19-8-13(20)14-12(16)7-18-9-15(14,17)11-5-3-2-4-6-11/h11-14,18-19H,2-10,17H2,1H3 |
| InChIKey | SSWOUHIGCPFEEZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |