C25H46F2N8O2 — CID 138645898
3,3-diamino-N-[4-[(9aS)-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)propanamide (PubChem CID 138645898) has the molecular formula C25H46F2N8O2 and a molecular weight of 528.69 g/mol. Its IUPAC name is 3,3-diamino-N-[4-[(9aS)-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-[(9aS)-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)propanamide |
|---|---|
| PubChem CID | 138645898 |
| Molecular Formula | C25H46F2N8O2 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | 3,3-diamino-N-[4-[(9aS)-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(5-fluoro-1-pentyl-1,3-diazinan-2-yl)propanamide |
| SMILES | CCCCCN1CC(F)CNC1C(C(=O)NC1CNCC(F)C1N1CCN2C(=O)CCC[C@H]2C1)C(N)N |
| InChI | InChI=1S/C25H46F2N8O2/c1-2-3-4-8-34-14-16(26)11-31-24(34)21(23(28)29)25(37)32-19-13-30-12-18(27)22(19)33-9-10-35-17(15-33)6-5-7-20(35)36/h16-19,21-24,30-31H,2-15,28-29H2,1H3,(H,32,37)/t16?,17-,18?,19?,21?,22?,24?/m0/s1 |
| InChIKey | WASQEWURQRFSJZ-BXSXWRBWSA-N |
| XLogP | -0.90 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|