C28H53FN6O — CID 138645961
3,3-diamino-2-(10-fluoro-8-azaspiro[4.7]dodecan-7-yl)-N-(4-hexyl-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-4-yl)propanamide (PubChem CID 138645961) has the molecular formula C28H53FN6O and a molecular weight of 508.77 g/mol. Its IUPAC name is 3,3-diamino-2-(10-fluoro-8-azaspiro[4.7]dodecan-7-yl)-N-(4-hexyl-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-4-yl)propanamide.
| Compound Name | 3,3-diamino-2-(10-fluoro-8-azaspiro[4.7]dodecan-7-yl)-N-(4-hexyl-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-4-yl)propanamide |
|---|---|
| PubChem CID | 138645961 |
| Molecular Formula | C28H53FN6O |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 508.43 |
| IUPAC Name | 3,3-diamino-2-(10-fluoro-8-azaspiro[4.7]dodecan-7-yl)-N-(4-hexyl-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-4-yl)propanamide |
| SMILES | CCCCCCC1(NC(=O)C(C(N)N)C2CC3(CCCC3)CCC(F)CN2)CNCC2C1CCN2C |
| InChI | InChI=1S/C28H53FN6O/c1-3-4-5-6-13-28(19-32-18-23-21(28)10-15-35(23)2)34-26(36)24(25(30)31)22-16-27(11-7-8-12-27)14-9-20(29)17-33-22/h20-25,32-33H,3-19,30-31H2,1-2H3,(H,34,36) |
| InChIKey | JDJGCOSJSSHYSX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|