C19H38FN5 — CID 138646079
5-fluoro-1-hexan-2-yl-4-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)piperidin-3-amine (PubChem CID 138646079) has the molecular formula C19H38FN5 and a molecular weight of 355.55 g/mol. Its IUPAC name is 5-fluoro-1-hexan-2-yl-4-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)piperidin-3-amine.
| Compound Name | 5-fluoro-1-hexan-2-yl-4-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 138646079 |
| Molecular Formula | C19H38FN5 |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | 5-fluoro-1-hexan-2-yl-4-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)piperidin-3-amine |
| SMILES | CCCCC(C)N1CC(N)C(N2CCN3CCN(C)CC3C2)C(F)C1 |
| InChI | InChI=1S/C19H38FN5/c1-4-5-6-15(2)25-13-17(20)19(18(21)14-25)24-10-9-23-8-7-22(3)11-16(23)12-24/h15-19H,4-14,21H2,1-3H3 |
| InChIKey | PYGPUIDJLHJWPR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |