About (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane
(6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane (PubChem CID 138646483) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane.
Molecular Properties
| Compound Name | (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane |
| PubChem CID | 138646483 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane |
| SMILES | C=C1CNCO/C1=C/C=C\C |
| InChI | InChI=1S/C9H13NO/c1-3-4-5-9-8(2)6-10-7-11-9/h3-5,10H,2,6-7H2,1H3/b4-3-,9-5+ |
| InChIKey | FBQYINRRMGIYOL-XBURUKCPSA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane?
The IUPAC name of (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane (CID 138646483) is (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane.
What is the SMILES notation for (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane?
The canonical SMILES for (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane is C=C1CNCO/C1=C/C=C\C.
What is the InChIKey of (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane?
The InChIKey is FBQYINRRMGIYOL-XBURUKCPSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-4-5-9-8(2)6-10-7-11-9/h3-5,10H,2,6-7H2,1H3/b4-3-,9-5+.
What are the key properties of (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane?
(6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane has a molecular weight of 151.21 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[(Z)-but-2-enylidene]-5-methylidene-1,3-oxazinane is sourced from PubChem (CID 138646483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).