C11H15NO — CID 138646495
3-prop-2-enyl-2,4,7,8-tetrahydro-1,3-benzoxazine (PubChem CID 138646495) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-prop-2-enyl-2,4,7,8-tetrahydro-1,3-benzoxazine.
| Compound Name | 3-prop-2-enyl-2,4,7,8-tetrahydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 138646495 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3-prop-2-enyl-2,4,7,8-tetrahydro-1,3-benzoxazine |
| SMILES | C=CCN1COC2=C(C=CCC2)C1 |
| InChI | InChI=1S/C11H15NO/c1-2-7-12-8-10-5-3-4-6-11(10)13-9-12/h2-3,5H,1,4,6-9H2 |
| InChIKey | AZKWVCRDJKEVTG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|