C11H7F4I3O5S — CID 138646572
1,1,2,2-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybutane-1-sulfonic acid (PubChem CID 138646572) has the molecular formula C11H7F4I3O5S and a molecular weight of 707.94 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 138646572 |
| Molecular Formula | C11H7F4I3O5S |
| Molecular Weight | 707.94 g/mol |
| Exact Mass | 707.71 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(2,3,5-triiodobenzoyl)oxybutane-1-sulfonic acid |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C11H7F4I3O5S/c12-10(13,11(14,15)24(20,21)22)1-2-23-9(19)6-3-5(16)4-7(17)8(6)18/h3-4H,1-2H2,(H,20,21,22) |
| InChIKey | KXVGEWKCBAFSQN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.94 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|