C27H33N3O2 — CID 138646645
N-[1-[2-(4-acetyl-3-ethyl-2-methylphenyl)ethyl]piperidin-4-yl]-5-ethynyl-4-methylpyridine-2-carboxamide (PubChem CID 138646645) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[1-[2-(4-acetyl-3-ethyl-2-methylphenyl)ethyl]piperidin-4-yl]-5-ethynyl-4-methylpyridine-2-carboxamide.
| Compound Name | N-[1-[2-(4-acetyl-3-ethyl-2-methylphenyl)ethyl]piperidin-4-yl]-5-ethynyl-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 138646645 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-[1-[2-(4-acetyl-3-ethyl-2-methylphenyl)ethyl]piperidin-4-yl]-5-ethynyl-4-methylpyridine-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)NC2CCN(CCc3ccc(C(C)=O)c(CC)c3C)CC2)cc1C |
| InChI | InChI=1S/C27H33N3O2/c1-6-21-17-28-26(16-18(21)3)27(32)29-23-11-14-30(15-12-23)13-10-22-8-9-25(20(5)31)24(7-2)19(22)4/h1,8-9,16-17,23H,7,10-15H2,2-5H3,(H,29,32) |
| InChIKey | LSPSQRKCDXVQTR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|