C15H21BrFNO — CID 138646840
3-[(1Z,3Z)-5-bromo-1-fluorohexa-1,3,5-trienyl]-1-butylpyrrolidine-2-carbaldehyde (PubChem CID 138646840) has the molecular formula C15H21BrFNO and a molecular weight of 330.24 g/mol. Its IUPAC name is 3-[(1Z,3Z)-5-bromo-1-fluorohexa-1,3,5-trienyl]-1-butylpyrrolidine-2-carbaldehyde.
| Compound Name | 3-[(1Z,3Z)-5-bromo-1-fluorohexa-1,3,5-trienyl]-1-butylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 138646840 |
| Molecular Formula | C15H21BrFNO |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[(1Z,3Z)-5-bromo-1-fluorohexa-1,3,5-trienyl]-1-butylpyrrolidine-2-carbaldehyde |
| SMILES | C=C(Br)/C=C\C=C(/F)C1CCN(CCCC)C1C=O |
| InChI | InChI=1S/C15H21BrFNO/c1-3-4-9-18-10-8-13(15(18)11-19)14(17)7-5-6-12(2)16/h5-7,11,13,15H,2-4,8-10H2,1H3/b6-5-,14-7- |
| InChIKey | VZAUROSLJJZBBB-GXMXSVIJSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|