C21H24ClFN2 — CID 138646880
4-but-1-en-2-yl-1-N-[3-(3-chloro-2-fluorophenyl)pent-4-en-2-yl]benzene-1,2-diamine (PubChem CID 138646880) has the molecular formula C21H24ClFN2 and a molecular weight of 358.89 g/mol. Its IUPAC name is 4-but-1-en-2-yl-1-N-[3-(3-chloro-2-fluorophenyl)pent-4-en-2-yl]benzene-1,2-diamine.
| Compound Name | 4-but-1-en-2-yl-1-N-[3-(3-chloro-2-fluorophenyl)pent-4-en-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 138646880 |
| Molecular Formula | C21H24ClFN2 |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-but-1-en-2-yl-1-N-[3-(3-chloro-2-fluorophenyl)pent-4-en-2-yl]benzene-1,2-diamine |
| SMILES | C=CC(c1cccc(Cl)c1F)C(C)Nc1ccc(C(=C)CC)cc1N |
| InChI | InChI=1S/C21H24ClFN2/c1-5-13(3)15-10-11-20(19(24)12-15)25-14(4)16(6-2)17-8-7-9-18(22)21(17)23/h6-12,14,16,25H,2-3,5,24H2,1,4H3 |
| InChIKey | XNCLSKGCMFUIJW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|