C23H28FN5OS — CID 138647122
N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-4,5-dimethyl-4,5-dihydropyrimidin-6-amine (PubChem CID 138647122) has the molecular formula C23H28FN5OS and a molecular weight of 441.58 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-4,5-dimethyl-4,5-dihydropyrimidin-6-amine.
| Compound Name | N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-4,5-dimethyl-4,5-dihydropyrimidin-6-amine |
|---|---|
| PubChem CID | 138647122 |
| Molecular Formula | C23H28FN5OS |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(3-methoxyphenyl)sulfanylpiperazin-1-yl]-4,5-dimethyl-4,5-dihydropyrimidin-6-amine |
| SMILES | COc1cccc(SN2CCN(C3=NC(C)C(C)C(Nc4ccc(F)cc4)=N3)CC2)c1 |
| InChI | InChI=1S/C23H28FN5OS/c1-16-17(2)25-23(27-22(16)26-19-9-7-18(24)8-10-19)28-11-13-29(14-12-28)31-21-6-4-5-20(15-21)30-3/h4-10,15-17H,11-14H2,1-3H3,(H,25,26,27) |
| InChIKey | QXEWEUWEIIFVMM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|