About 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine
1-[2-(6,6-dimethylheptoxy)ethyl]piperazine (PubChem CID 138648090) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine.
Molecular Properties
| Compound Name | 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine |
| PubChem CID | 138648090 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine |
| SMILES | CC(C)(C)CCCCCOCCN1CCNCC1 |
| InChI | InChI=1S/C15H32N2O/c1-15(2,3)7-5-4-6-13-18-14-12-17-10-8-16-9-11-17/h16H,4-14H2,1-3H3 |
| InChIKey | ZHIRECMTRJCBAU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine?
The IUPAC name of 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine (CID 138648090) is 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine.
What is the SMILES notation for 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine?
The canonical SMILES for 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine is CC(C)(C)CCCCCOCCN1CCNCC1.
What is the InChIKey of 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine?
The InChIKey is ZHIRECMTRJCBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O/c1-15(2,3)7-5-4-6-13-18-14-12-17-10-8-16-9-11-17/h16H,4-14H2,1-3H3.
What are the key properties of 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine?
1-[2-(6,6-dimethylheptoxy)ethyl]piperazine has a molecular weight of 256.43 g/mol, XLogP of 2.51, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6,6-dimethylheptoxy)ethyl]piperazine is sourced from PubChem (CID 138648090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).