About 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine
6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine (PubChem CID 138648265) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine.
Molecular Properties
| Compound Name | 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine |
| PubChem CID | 138648265 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine |
| SMILES | CN(C)c1ccc(NC(C)(C)C)nn1 |
| InChI | InChI=1S/C10H18N4/c1-10(2,3)11-8-6-7-9(13-12-8)14(4)5/h6-7H,1-5H3,(H,11,12) |
| InChIKey | VOVJTJFLWMEUIZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine?
The IUPAC name of 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine (CID 138648265) is 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine.
What is the SMILES notation for 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine?
The canonical SMILES for 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine is CN(C)c1ccc(NC(C)(C)C)nn1.
What is the InChIKey of 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine?
The InChIKey is VOVJTJFLWMEUIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-10(2,3)11-8-6-7-9(13-12-8)14(4)5/h6-7H,1-5H3,(H,11,12).
What are the key properties of 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine?
6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine has a molecular weight of 194.28 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-tert-butyl-3-N,3-N-dimethylpyridazine-3,6-diamine is sourced from PubChem (CID 138648265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).