About 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide
2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide (PubChem CID 138648416) has the molecular formula C10H18F2N2
and a molecular weight of 204.26 g/mol. Its IUPAC name is 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide.
Molecular Properties
| Compound Name | 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide |
| PubChem CID | 138648416 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide |
| SMILES | C/C=C(/F)C(C)/N=C(\CF)NC(C)C |
| InChI | InChI=1S/C10H18F2N2/c1-5-9(12)8(4)14-10(6-11)13-7(2)3/h5,7-8H,6H2,1-4H3,(H,13,14)/b9-5+ |
| InChIKey | TXVJHGSFVOXANM-WEVVVXLNSA-N |
| XLogP | 2.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide?
The IUPAC name of 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide (CID 138648416) is 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide.
What is the SMILES notation for 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide?
The canonical SMILES for 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide is C/C=C(/F)C(C)/N=C(\CF)NC(C)C.
What is the InChIKey of 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide?
The InChIKey is TXVJHGSFVOXANM-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H18F2N2/c1-5-9(12)8(4)14-10(6-11)13-7(2)3/h5,7-8H,6H2,1-4H3,(H,13,14)/b9-5+.
What are the key properties of 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide?
2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide has a molecular weight of 204.26 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-[(E)-3-fluoropent-3-en-2-yl]-N-propan-2-ylethanimidamide is sourced from PubChem (CID 138648416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).