About (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine
(4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine (PubChem CID 138648504) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine.
Molecular Properties
| Compound Name | (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine |
| PubChem CID | 138648504 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine |
| SMILES | [H]/N=C(\C)C(=C)C(=C/C)/C(=C\C)CCC |
| InChI | InChI=1S/C13H21N/c1-6-9-12(7-2)13(8-3)10(4)11(5)14/h7-8,14H,4,6,9H2,1-3,5H3/b12-7-,13-8-,14-11+ |
| InChIKey | CRXYDCJIPNADPW-MSRAAJIISA-N |
| XLogP | 4.27 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine?
The IUPAC name of (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine (CID 138648504) is (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine.
What is the SMILES notation for (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine?
The canonical SMILES for (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine is [H]/N=C(\C)C(=C)C(=C/C)/C(=C\C)CCC.
What is the InChIKey of (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine?
The InChIKey is CRXYDCJIPNADPW-MSRAAJIISA-N. The full InChI is InChI=1S/C13H21N/c1-6-9-12(7-2)13(8-3)10(4)11(5)14/h7-8,14H,4,6,9H2,1-3,5H3/b12-7-,13-8-,14-11+.
What are the key properties of (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine?
(4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine has a molecular weight of 191.32 g/mol, XLogP of 4.27, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5Z)-4,5-di(ethylidene)-3-methylideneoctan-2-imine is sourced from PubChem (CID 138648504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).